
CAS 73936-80-8
:2-(1-Methyl-1-phenylethyl)-4-(1,1,3,3-tetramethylbutyl)phenol
Description:
2-(1-Methyl-1-phenylethyl)-4-(1,1,3,3-tetramethylbutyl)phenol, identified by its CAS number 73936-80-8, is an organic compound that belongs to the class of phenolic compounds. This substance features a complex structure characterized by a phenolic core substituted with bulky alkyl groups, which contribute to its unique physical and chemical properties. It is typically a solid at room temperature and exhibits low solubility in water, while being more soluble in organic solvents. The presence of multiple alkyl groups enhances its hydrophobicity and stability, making it useful in various applications, including as an antioxidant in plastics and rubber products. Additionally, its molecular structure suggests potential for steric hindrance, which may influence its reactivity and interactions with other chemical species. Overall, this compound is notable for its role in enhancing the durability and longevity of materials by preventing oxidative degradation.
Formula:C23H32O
InChI:InChI=1S/C23H32O/c1-21(2,3)16-22(4,5)18-13-14-20(24)19(15-18)23(6,7)17-11-9-8-10-12-17/h8-15,24H,16H2,1-7H3
InChI key:InChIKey=ONHZKWDILKBQLS-UHFFFAOYSA-N
SMILES:C(C)(C)(C1=CC(C(CC(C)(C)C)(C)C)=CC=C1O)C2=CC=CC=C2
Synonyms:- 2-(1-Methyl-1-phenylethyl)-4-(1,1,3,3-tetramethylbutyl)phenol
- 2-(α,α-Dimethylbenzyl)-4-tert-octylphenol
- 2-α-Cumyl-4-tert-octylphenol
- Phenol, 2-(1-methyl-1-phenylethyl)-4-(1,1,3,3-tetramethylbutyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.