CymitQuimica logo

CAS 739361-61-6

:

[2-Bromo-5-(trifluoromethyl)phenyl]hydrazine

Description:
[2-Bromo-5-(trifluoromethyl)phenyl]hydrazine is an organic compound characterized by its hydrazine functional group attached to a phenyl ring that is substituted with both a bromine atom and a trifluoromethyl group. The presence of the bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its physical properties, such as boiling and melting points. The trifluoromethyl group is known for its electron-withdrawing properties, which can significantly affect the compound's chemical behavior, making it more electrophilic. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its potential as a building block for more complex molecules. It may exhibit specific biological activities, but detailed studies would be necessary to elucidate its full range of properties and applications. Safety precautions should be taken when handling this compound, as it may pose health risks typical of hydrazine derivatives, including toxicity and potential carcinogenicity.
Formula:C7H6BrF3N2
InChI:InChI=1/C7H6BrF3N2/c8-5-2-1-4(7(9,10)11)3-6(5)13-12/h1-3,13H,12H2
SMILES:c1cc(c(cc1C(F)(F)F)NN)Br
Synonyms:
  • Hydrazine, [2-Bromo-5-(Trifluoromethyl)Phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.