
CAS 739364-96-6
:2,5,7-Trimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
Description:
2,5,7-Trimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features three methyl groups at the 2, 5, and 7 positions, contributing to its lipophilicity and potentially influencing its biological activity. The presence of a carboxylic acid functional group at the 6-position enhances its polarity and solubility in polar solvents, making it suitable for various chemical reactions and applications. It is often studied for its potential pharmacological properties, including anti-inflammatory and anti-cancer activities. The compound's molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its stability and reactivity can be influenced by the substituents on the rings, which may affect its synthesis and application in drug development. Overall, 2,5,7-Trimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid represents a versatile scaffold in the field of organic and medicinal chemistry.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c1-5-4-8-11-6(2)9(10(14)15)7(3)13(8)12-5/h4H,1-3H3,(H,14,15)
InChI key:InChIKey=DQMYHPAMVMIEKJ-UHFFFAOYSA-N
SMILES:CC=1N2C(N=C(C)C1C(O)=O)=CC(C)=N2
Synonyms:- Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 2,5,7-trimethyl-
- 2,5,7-Trimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.