
CAS 739364-97-7
:7-Methoxy-2,5-dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
Description:
7-Methoxy-2,5-dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a methoxy group and two methyl groups, contributing to its unique chemical properties and potential biological activity. The carboxylic acid functional group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The presence of the methoxy group can also affect the compound's electronic properties and steric hindrance, potentially impacting its pharmacological profile. As a member of the pyrazolo-pyrimidine class, it may exhibit various biological activities, including anti-inflammatory or anti-cancer properties, making it of interest in medicinal chemistry. The compound's CAS number, 739364-97-7, allows for its identification in chemical databases and literature, facilitating research and development efforts. Overall, this compound represents a promising scaffold for further exploration in drug discovery and development.
Formula:C10H11N3O3
InChI:InChI=1S/C10H11N3O3/c1-5-4-7-11-6(2)8(10(14)15)9(16-3)13(7)12-5/h4H,1-3H3,(H,14,15)
InChI key:InChIKey=KSTQFKHUASWVSA-UHFFFAOYSA-N
SMILES:O(C)C=1N2C(N=C(C)C1C(O)=O)=CC(C)=N2
Synonyms:- Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 7-methoxy-2,5-dimethyl-
- 7-Methoxy-2,5-dimethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.