CAS 739365-03-8
:7-Hydroxy-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
Description:
7-Hydroxy-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a hydroxyl group at the 7-position and a carboxylic acid functional group at the 6-position, contributing to its potential as a bioactive molecule. The presence of the methyl group at the 2-position enhances its lipophilicity, which may influence its biological activity and solubility. The compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and analgesic effects. Its unique structural features allow for interactions with various biological targets, making it a candidate for further research in drug development. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, which may affect its synthesis and application in various chemical contexts. Overall, 7-Hydroxy-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid represents a valuable compound for exploration in both synthetic and medicinal chemistry.
Formula:C8H7N3O3
InChI:InChI=1S/C8H7N3O3/c1-4-2-6-9-3-5(8(13)14)7(12)11(6)10-4/h2-3,12H,1H3,(H,13,14)
InChI key:InChIKey=CYWMDGLKMSQVMR-UHFFFAOYSA-N
SMILES:OC=1N2C(N=CC1C(O)=O)=CC(C)=N2
Synonyms:- 7-Hydroxy-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
- Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 7-hydroxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.