CAS 739365-04-9

Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 2-(hydroxymethyl)-

Description:

Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 2-(hydroxymethyl)- is a heterocyclic compound characterized by its pyrazolo and pyrimidine ring structures, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its acidity and reactivity, and a hydroxymethyl group that can participate in hydrogen bonding and influence its solubility in polar solvents. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit biological activity. Additionally, the compound's molecular structure may allow for various synthetic modifications, making it a versatile building block in organic synthesis. Its CAS number, 739365-04-9, facilitates its identification in chemical databases and literature. Overall, this compound represents an interesting subject for further research, particularly in the fields of drug discovery and material science.

Formula: C₈H₇N₃O₃

InChI: InChI=1S/C8H7N3O3/c12-4-6-1-7-9-2-5(8(13)14)3-11(7)10-6/h1-3,12H,4H2,(H,13,14)

InChI key: InChIKey=JCGSFBMGCRLDTJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CN2C(=CC(CO)=N2)N=C1

Synonyms:

• 2-(Hydroxymethyl)pyrazolo[1,5-a]pyrimidine-6-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 2-(hydroxymethyl)-