CymitQuimica logo

CAS 739365-05-0

:

Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 2-(methoxymethyl)-

Description:
Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 2-(methoxymethyl)- is a heterocyclic compound characterized by its pyrazolo and pyrimidine ring structures, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which is known for its acidity and ability to participate in various chemical reactions, including esterification and amidation. The presence of the methoxymethyl group enhances its solubility and may influence its biological activity. Pyrazolo[1,5-a]pyrimidines are often studied for their potential pharmacological applications, including anti-inflammatory and anticancer properties. The compound's structure allows for various substitution patterns, which can be explored to optimize its activity. Additionally, its molecular interactions can be influenced by the presence of the methoxymethyl group, making it a subject of interest in medicinal chemistry. Overall, this compound exemplifies the diverse chemistry of heterocycles and their potential utility in drug development.
Formula:C9H9N3O3
InChI:InChI=1S/C9H9N3O3/c1-15-5-7-2-8-10-3-6(9(13)14)4-12(8)11-7/h2-4H,5H2,1H3,(H,13,14)
InChI key:InChIKey=CTEFMPLNGNDKLS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CN2C(=CC(COC)=N2)N=C1
Synonyms:
  • Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 2-(methoxymethyl)-
  • 2-(Methoxymethyl)pyrazolo[1,5-a]pyrimidine-6-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.