CAS 739365-26-5

4-Methoxy-2-methyl-6-benzothiazolecarboxylic acid

Description:

4-Methoxy-2-methyl-6-benzothiazolecarboxylic acid is an organic compound characterized by its benzothiazole structure, which incorporates a methoxy group and a carboxylic acid functional group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid, while the benzothiazole moiety may contribute to its aromatic characteristics. The methoxy group can influence the compound's reactivity and polarity, potentially enhancing its solubility in organic solvents. As a benzothiazole derivative, it may exhibit biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential applications in various fields, including agrochemicals and materials science. Its specific reactivity and interactions would depend on the functional groups present, making it a candidate for further studies in synthesis and application. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₀H₉NO₃S

InChI: InChI=1S/C10H9NO3S/c1-5-11-9-7(14-2)3-6(10(12)13)4-8(9)15-5/h3-4H,1-2H3,(H,12,13)

InChI key: InChIKey=DOVAMLFLRFKHDJ-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=CC(C(O)=O)=C1)SC(C)=N2

Synonyms:

• 6-Benzothiazolecarboxylic acid, 4-methoxy-2-methyl-
• 4-Methoxy-2-methyl-6-benzothiazolecarboxylic acid