CymitQuimica logo

CAS 739365-30-1

:

4-methyl-2,3-dihydro-1H-isoindole

Description:
4-Methyl-2,3-dihydro-1H-isoindole is a bicyclic organic compound characterized by its isoindole structure, which consists of a fused benzene and pyrrole ring. This compound features a methyl group at the 4-position of the isoindole framework, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the dihydro group indicates that it has two hydrogen atoms added to the isoindole structure, which can influence its reactivity and stability. 4-Methyl-2,3-dihydro-1H-isoindole is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in the synthesis of more complex molecules. Its reactivity can be attributed to the presence of the nitrogen atom in the ring, which can participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks. Overall, this compound serves as a valuable building block in organic synthesis and drug development.
Formula:C9H11N
InChI:InChI=1/C9H11N/c1-7-3-2-4-8-5-10-6-9(7)8/h2-4,10H,5-6H2,1H3
SMILES:Cc1cccc2CNCc12
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.