CAS 739366-01-9

Ethyl 4,5-dihydro-2-methyl-5-oxopyrazolo[1,5-a]pyrimidine-6-carboxylate

Description:

Ethyl 4,5-dihydro-2-methyl-5-oxopyrazolo[1,5-a]pyrimidine-6-carboxylate is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure. This compound features a fused ring system that includes both pyrazole and pyrimidine moieties, contributing to its potential biological activity. The presence of the ethyl ester group enhances its solubility and reactivity, making it suitable for various chemical reactions and applications. Typically, compounds of this nature may exhibit pharmacological properties, including anti-inflammatory or antimicrobial activities, although specific biological data would depend on empirical studies. The molecular structure includes functional groups such as carbonyl and carboxylate, which can participate in hydrogen bonding and other interactions, influencing its reactivity and stability. As with many heterocycles, the electronic properties and steric factors play a crucial role in determining its behavior in chemical reactions and interactions with biological targets. Overall, this compound represents a class of molecules that are of interest in medicinal chemistry and drug development.

Formula: C₁₀H₁₁N₃O₃

InChI: InChI=1S/C10H11N3O3/c1-3-16-10(15)7-5-13-8(11-9(7)14)4-6(2)12-13/h4-5H,3H2,1-2H3,(H,11,14)

InChI key: InChIKey=KCBXCJFFWYBRFL-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CN2C(NC1=O)=CC(C)=N2

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 4,5-dihydro-2-methyl-5-oxo-, ethyl ester
• Ethyl 4,5-dihydro-2-methyl-5-oxopyrazolo[1,5-a]pyrimidine-6-carboxylate