
CAS 73941-30-7
:Hydroxylamine, O-(3-phenylpropyl)-, hydrochloride (1:1)
Description:
Hydroxylamine, O-(3-phenylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its hydroxylamine functional group, which is known for its reactivity, particularly in organic synthesis. This compound features a phenylpropyl moiety, contributing to its potential applications in medicinal chemistry and as a building block in organic synthesis. The hydrochloride form indicates that it is a salt, which enhances its solubility in water and may influence its stability and reactivity. Hydroxylamines are generally used as reducing agents and can participate in various chemical reactions, including the formation of oximes from carbonyl compounds. The presence of the phenyl group may also impart specific electronic properties, affecting its reactivity and interaction with biological systems. Safety data should be consulted, as hydroxylamines can be hazardous, with potential for toxicity and reactivity under certain conditions. Overall, this compound's unique structure and properties make it a subject of interest in both research and industrial applications.
Formula:C9H13NO·ClH
InChI:InChI=1S/C9H13NO.ClH/c10-11-8-4-7-9-5-2-1-3-6-9;/h1-3,5-6H,4,7-8,10H2;1H
InChI key:InChIKey=FGFZOPSQLFBVLQ-UHFFFAOYSA-N
SMILES:C(CCON)C1=CC=CC=C1.Cl
Synonyms:- Propoxyamine, 3-phenyl-, hydrochloride
- Hydroxylamine, O-(3-phenylpropyl)-, hydrochloride (1:1)
- Hydroxylamine, O-(3-phenylpropyl)-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.