CAS 73943-41-6
:2-fluoro-6-methoxyphenol
Description:
2-Fluoro-6-methoxyphenol, with the CAS number 73943-41-6, is an organic compound characterized by the presence of a fluorine atom and a methoxy group attached to a phenolic ring. This compound typically exhibits properties associated with phenols, such as being a weak acid due to the hydroxyl (-OH) group, which can donate protons in solution. The presence of the methoxy group enhances its lipophilicity, potentially affecting its solubility in organic solvents. The fluorine atom can influence the compound's reactivity and stability, often enhancing its electrophilic character. 2-Fluoro-6-methoxyphenol may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various applications in organic synthesis and as an intermediate in the production of more complex chemical entities. Overall, the unique combination of functional groups in this compound contributes to its distinctive chemical behavior and potential utility in various chemical and biological contexts.
Formula:C7H7FO2
InChI:InChI=1/C7H7FO2/c1-10-6-4-2-3-5(8)7(6)9/h2-4,9H,1H3
SMILES:COc1cccc(c1O)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Fluoro-6-methoxyphenol, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H7FO2Purity:97%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:142.132-Fluoro-6-methoxyphenol
CAS:Formula:C7H7FO2Purity:97%Color and Shape:LiquidMolecular weight:142.12772-Fluoro-6-methoxyphenol
CAS:2-Fluoro-6-methoxyphenolFormula:C7H7FO2Purity:98%Color and Shape: pale yellow solidMolecular weight:142.13g/mol



