CAS 73945-46-7
:7-Chloro-L-tryptophan
Description:
7-Chloro-L-tryptophan is an amino acid derivative and a halogenated form of L-tryptophan, characterized by the presence of a chlorine atom at the 7-position of the indole ring. This modification can influence its biochemical properties and interactions. The compound is typically a white to off-white crystalline solid, soluble in polar solvents such as water and methanol, but less soluble in non-polar solvents. It is often used in biochemical research, particularly in studies related to protein synthesis and enzyme activity, due to its ability to act as a substrate or inhibitor in various biological processes. The presence of the chlorine atom can also affect its reactivity and stability compared to its non-chlorinated counterpart. Additionally, 7-Chloro-L-tryptophan may exhibit unique pharmacological properties, making it of interest in medicinal chemistry and drug development. As with many amino acid derivatives, it is important to handle this compound with care, following appropriate safety protocols in laboratory settings.
Formula:C11H11ClN2O2
InChI:InChI=1S/C11H11ClN2O2/c12-8-3-1-2-7-6(5-14-10(7)8)4-9(13)11(15)16/h1-3,5,9,14H,4,13H2,(H,15,16)/t9-/m0/s1
InChI key:InChIKey=DMQFGLHRDFQKNR-VIFPVBQESA-N
SMILES:C([C@@H](C(O)=O)N)C=1C=2C(NC1)=C(Cl)C=CC2
Synonyms:- (2S)-2-Amino-3-(7-chloro-1H-indol-3-yl)propanoic acid
- L-Tryptophan, 7-chloro-
- 7-Chloro-L-tryptophan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
7-Chloro-L-tryptophan
CAS:Formula:C11H11ClN2O2Purity:97%Color and Shape:SolidMolecular weight:238.67027-Chloro-L-Tryptophan
CAS:Controlled ProductStability Hygroscopic
Applications 7-CHLORO-L-TRYPTOPHAN (cas# 73945-46-7) is a useful research chemical.Formula:C11H11N2O2ClColor and Shape:NeatMolecular weight:238.677-Chloro-L-tryptophan
CAS:7-Chloro-L-tryptophan (7-CT) is a molecule that consists of a disulfide bond and two amino acids. 7-CT is used as a diagnostic agent to detect injuries in cells. It can be used to diagnose diseases such as traumatic brain injury, bowel disease, and encephalopathy. 7-CT is also an active ingredient in antiretroviral therapy, which suppresses the replication of HIV and can also be used for the treatment of AIDS. The most common way that 7-CT interacts with other molecules is through hydrogen bonding interactions. This molecule has been shown to have semiconductor properties, which make it useful in electronics applications. It has also been shown to have thermal expansion properties that are similar to those found in silicon or germanium.Formula:C11H11ClN2O2Color and Shape:PowderMolecular weight:238.67 g/mol7-CHLORO-L-TRYPTOPHAN
CAS:Formula:C11H11ClN2O2Purity:97%Color and Shape:Liquid, No data available.Molecular weight:238.67





