CAS 73946-92-6
:1,1',1''-phosphanetriyltris(1H-imidazole)
Description:
1,1',1''-Phosphanetriyltris(1H-imidazole) is a chemical compound characterized by the presence of a central phosphorus atom bonded to three imidazole rings. This compound features a trivalent phosphorus center, which is significant in coordination chemistry and can exhibit various oxidation states. The imidazole rings contribute to the compound's potential as a ligand, allowing it to interact with metal ions and participate in coordination complexes. The presence of nitrogen atoms in the imidazole structure can enhance the compound's ability to form hydrogen bonds and engage in various chemical reactions. Additionally, the compound may exhibit interesting biological activities due to the imidazole moiety, which is commonly found in many biologically active molecules. Its unique structure and properties make it a subject of interest in fields such as medicinal chemistry, materials science, and catalysis. However, specific applications and reactivity would depend on the context of its use and the presence of other reactants or conditions.
Formula:C9H9N6P
InChI:InChI=1/C9H9N6P/c1-4-13(7-10-1)16(14-5-2-11-8-14)15-6-3-12-9-15/h1-9H
SMILES:c1cn(cn1)P(n1ccnc1)n1ccnc1
Synonyms:- 1H-imidazole, 1,1',1''-phosphinidynetris-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.