CymitQuimica logo

CAS 73955-55-2

:

methyl 2-methylpyrimidine-4-carboxylate

Description:
Methyl 2-methylpyrimidine-4-carboxylate, identified by its CAS number 73955-55-2, is an organic compound characterized by a pyrimidine ring substituted with a methyl group and a carboxylate functional group. This compound typically exhibits a polar nature due to the presence of the carboxylate group, which can engage in hydrogen bonding and influence its solubility in polar solvents like water and alcohols. The methyl group contributes to its hydrophobic characteristics, affecting its overall solubility profile. Methyl 2-methylpyrimidine-4-carboxylate is often utilized in organic synthesis and pharmaceutical applications, serving as an intermediate in the production of various bioactive compounds. Its reactivity is influenced by the electron-withdrawing nature of the carboxylate group, which can enhance electrophilic substitution reactions on the pyrimidine ring. Additionally, the compound's stability and behavior under different conditions can be affected by factors such as temperature and pH, making it a subject of interest in both academic and industrial research settings.
Formula:C7H8N2O2
InChI:InChI=1/C7H8N2O2/c1-5-8-4-3-6(9-5)7(10)11-2/h3-4H,1-2H3
InChI key:HEUBBCMIYRXETJ-UHFFFAOYSA-N
SMILES:Cc1nccc(C(=O)OC)n1
Found 4 products.