CAS 7396-79-4

2-chloro-1-(2,5-dichlorophenyl)ethanone

Description:

2-Chloro-1-(2,5-dichlorophenyl)ethanone, with the CAS number 7396-79-4, is an organic compound characterized by its ketone functional group and the presence of chlorine substituents. This compound features a chloro group attached to the ethyl carbon adjacent to a carbonyl group, along with a dichlorophenyl group, which significantly influences its chemical reactivity and physical properties. It is typically a solid at room temperature and may exhibit a crystalline structure. The presence of multiple chlorine atoms contributes to its potential as a halogenated organic compound, which can affect its solubility in various solvents and its reactivity in chemical reactions. Additionally, compounds like this may have applications in organic synthesis, agrochemicals, or pharmaceuticals, although specific uses can vary based on further research and development. Safety considerations are important, as halogenated compounds can pose environmental and health risks, necessitating proper handling and disposal protocols.

Formula: C₈H₅Cl₃O

InChI: InChI=1/C8H5Cl3O/c9-4-8(12)6-3-5(10)1-2-7(6)11/h1-3H,4H2

SMILES: c1cc(c(cc1Cl)C(=O)CCl)Cl

2',2,5 Trichloroacetophenone

CAS: 7396-79-4

Formula: C₈H₅Cl₃O

Molecular weight: 223.48

Ref: 4Z-A-128007

2,2',5'-Trichloroacetophenone

Controlled Product

CAS: 7396-79-4

Applications 2,2',5'-Trichloroacetophenone is a useful research chemical for organic synthesis and other chemical processes.
References Xu, L., et al.: Chem. Res. Chin. Univ., 24, 299 (2008); Song, W., et al.: MedChemComm, 7, 1441 (2016)

Formula: C₈H₅Cl₃O

Color and Shape: Neat

Molecular weight: 223.48

Ref: TR-T891530

2-Chloro-1-(2,5-dichlorophenyl)ethan-1-one

CAS: 7396-79-4

Versatile small molecule scaffold

Formula: C₈H₅Cl₃O

Purity: Min. 95%

Molecular weight: 223.5 g/mol

Ref: 3D-HAA39679

2',2,5 Trichloroacetophenone

CAS: 7396-79-4

Formula: C₈H₅Cl₃O

Molecular weight: 223.48

Ref: ST-EA-CP-A265007