CAS 7396-99-8
:1-(2,4-dimethylphenyl)-2,2-dimethylpropan-1-one
Description:
1-(2,4-Dimethylphenyl)-2,2-dimethylpropan-1-one, also known as benzyl isobutyl ketone, is an organic compound characterized by its ketone functional group and a complex aromatic structure. It features a 2,4-dimethylphenyl group attached to a propanone backbone, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water. The compound is primarily used in the synthesis of various organic materials and as an intermediate in the production of fragrances and flavoring agents. Its chemical stability and reactivity make it suitable for applications in the chemical industry, although safety precautions are necessary due to potential irritant properties. As with many organic compounds, handling should be done with care, following appropriate safety guidelines to mitigate any health risks associated with exposure.
Formula:C13H18O
InChI:InChI=1/C13H18O/c1-9-6-7-11(10(2)8-9)12(14)13(3,4)5/h6-8H,1-5H3
SMILES:Cc1ccc(c(C)c1)C(=O)C(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.