CymitQuimica logo

CAS 73962-28-4

:

2-chloro-6-fluorobenzaldehyde thiosemicarbazone

Description:
2-Chloro-6-fluorobenzaldehyde thiosemicarbazone is an organic compound characterized by its thiosemicarbazone functional group, which is derived from the condensation of thiosemicarbazide with 2-chloro-6-fluorobenzaldehyde. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of both chlorine and fluorine substituents on the aromatic ring can influence its reactivity and biological activity, often enhancing its lipophilicity and potentially affecting its interaction with biological targets. Thiosemicarbazones are known for their diverse pharmacological properties, including antimicrobial and anticancer activities, making this compound of interest in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 2-chloro-6-fluorobenzaldehyde thiosemicarbazone represents a valuable structure for further research in both synthetic and medicinal chemistry contexts.
Formula:C8H7ClFN3S
InChI:InChI=1/C8H7ClFN3S/c9-6-2-1-3-7(10)5(6)4-12-13-8(11)14/h1-4H,(H3,11,13,14)/b12-4-
SMILES:c1cc(c(/C=N\NC(=N)S)c(c1)F)Cl
Synonyms:
  • benzaldehyde, 2-chloro-6-fluoro-, 2-[(1Z)-aminomercaptomethylene]hydrazone
  • N'-[(Z)-(2-Chloro-6-fluorophenyl)methylene]carbamohydrazonothioic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.