CAS 73963-34-5

5-(3-Chloropropyl)-1-phenyl-1H-tetrazole

Description:

5-(3-Chloropropyl)-1-phenyl-1H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms. This compound features a phenyl group and a 3-chloropropyl substituent, contributing to its unique chemical properties. The presence of the chlorine atom enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The tetrazole moiety is known for its ability to form stable complexes with metal ions and can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, compounds containing tetrazole rings have been studied for their potential applications in pharmaceuticals, agrochemicals, and as energetic materials. The molecular structure and substituents of 5-(3-Chloropropyl)-1-phenyl-1H-tetrazole suggest that it may exhibit interesting physical and chemical properties, such as solubility in organic solvents and potential biological activity, warranting further investigation in various fields of research.

Formula: C₁₀H₁₁ClN₄

InChI: InChI=1S/C10H11ClN4/c11-8-4-7-10-12-13-14-15(10)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2

InChI key: InChIKey=DALGHUJUPOTHSH-UHFFFAOYSA-N

SMILES: C(CCCl)C=1N(N=NN1)C2=CC=CC=C2

Synonyms:

• 5-(3-Chloropropyl)-1-phenyl-1H-tetrazole
• 1H-Tetrazole, 5-(3-chloropropyl)-1-phenyl-

5-(3-Chloropropyl)-1-Phenyl-1H-1,2,3,4-Tetrazole

CAS: 73963-34-5

Formula: C₁₀H₁₁ClN₄

Molecular weight: 222.68

Ref: 4Z-B-139108

5-(3-Chloropropyl)-1-phenyl-1H-1,2,3,4-tetrazole

Controlled Product

CAS: 73963-34-5

Applications 5-(3-Chloropropyl)-1-phenyl-1H-1,2,3,4-tetrazole (cas# 73963-34-5) is a useful compound for developing novel disubstituted tetrazoles.
References Li, L. H., et al.: Chem. Commun. (Cambridge, UK), 54, 11148 (2018)

Formula: C₁₀H₁₁N₄Cl

Color and Shape: Neat

Molecular weight: 222.67

Ref: TR-C214673