CAS 7397-23-1

3-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)prop-2-en-1-one

Description:

3-(1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)prop-2-en-1-one, also known by its CAS number 7397-23-1, is an organic compound characterized by its unique structural features, including a prop-2-en-1-one backbone substituted with a benzodioxole and a fluorophenyl group. This compound typically exhibits properties associated with both aromatic and unsaturated systems, which can influence its reactivity and stability. The presence of the benzodioxole moiety may impart specific biological activities, as this structure is often found in various natural products and pharmaceuticals. The fluorine atom in the para position of the phenyl ring can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its interactions with biological targets. As a result, compounds like this one are of interest in medicinal chemistry and material science. Its synthesis and characterization may involve standard organic reactions, and it can be analyzed using techniques such as NMR, IR spectroscopy, and mass spectrometry to confirm its structure and purity.

Formula: C₁₆H₁₁FO₃

InChI: InChI=1/C16H11FO3/c17-13-5-3-12(4-6-13)14(18)7-1-11-2-8-15-16(9-11)20-10-19-15/h1-9H,10H2

SMILES: C(=CC(=O)c1ccc(cc1)F)c1ccc2c(c1)OCO2

(2E)-3-(2H-1,3-benzodioxol-5-yl)-1-(4-fluorophenyl)prop-2-en-1-one

CAS: 7397-23-1

Purity: 95.0%

Molecular weight: 270.2590026855469

Ref: 10-F523846