CAS 7397-89-9
:(3S,5S)-3-hydroxy-3,5-bis(hydroxymethyl)dihydrofuran-2(3H)-one (non-preferred name)
Description:
The chemical substance known as (3S,5S)-3-hydroxy-3,5-bis(hydroxymethyl)dihydrofuran-2(3H)-one, with the CAS number 7397-89-9, is a bicyclic compound featuring a furan ring. It is characterized by the presence of multiple hydroxymethyl groups, which contribute to its hydrophilicity and potential reactivity. The stereochemistry indicated by the (3S,5S) configuration suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions. This compound is often studied for its potential applications in pharmaceuticals and biochemistry, particularly due to its structural similarity to certain natural products. Its hydroxyl groups may participate in hydrogen bonding, affecting solubility and stability in various solvents. Additionally, the dihydrofuran moiety may exhibit unique chemical reactivity, making it a subject of interest in synthetic organic chemistry. Overall, this compound's unique structural features and functional groups position it as a valuable entity in chemical research and development.
Formula:C6H10O5
InChI:InChI=1/C6H10O5/c7-2-4-1-6(10,3-8)5(9)11-4/h4,7-8,10H,1-3H2/t4-,6-/m0/s1
SMILES:C1[C@@H](CO)OC(=O)[C@]1(CO)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
ISOSACCHARINIC ACID-1,4-LACTONE
CAS:Formula:C6H10O5Purity:95%Color and Shape:SolidMolecular weight:162.1406Isosaccharinic acid-1,4-lactone
CAS:Formula:C6H10O5Purity:≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:162.14Isosaccharinic acid-1,4-lactone
CAS:Isosaccharinic acid-1,4-lactone is an organic compound that is found in human urine. It has been shown that the concentration of this compound can be used as a marker for renal health. The hydrated form of isosaccharinic acid-1,4-lactone can be prepared by heating with acetic anhydride, and it has been shown to have potential applications as a buffer in diagnostic tests for human serum or as a stabilizer for x-ray structures. The 1H NMR spectrum of isosaccharinic acid-1,4-lactone reveals two distinct signals at 1.6 and 2.0 ppm, which are assigned to the two isomers of this compound. The second order rate constant was measured to be 0.025 s−1 at pH 7 and 22 °C using acetate extract from human urine. This technique was also applied to measure rates constant for other organic acids such as formic acidFormula:C6H10O5Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:162.14 g/mol



