CAS 7397-92-4
:1-bromoanthracene
Description:
1-Bromoanthracene is an organic compound characterized by the presence of a bromine atom attached to the anthracene structure, which consists of three fused benzene rings. Its molecular formula is C14H9Br, and it is classified as a polycyclic aromatic hydrocarbon (PAH). This compound typically appears as a solid, often in the form of yellow to brown crystals. 1-Bromoanthracene is known for its relatively high melting point and moderate solubility in organic solvents such as dichloromethane and acetone, while being less soluble in water. It is utilized in various applications, including organic synthesis and as a reagent in chemical reactions, particularly in the formation of other brominated compounds. Additionally, 1-bromoanthracene can serve as a precursor in the development of materials for organic electronics and photonics. Due to the presence of the bromine atom, it exhibits unique reactivity patterns, making it valuable in synthetic organic chemistry. As with many brominated compounds, it is important to handle 1-bromoanthracene with care due to potential health and environmental concerns.
Formula:C14H9Br
InChI:InChI=1/C14H9Br/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H
SMILES:c1ccc2cc3c(cccc3Br)cc2c1
Synonyms:- Anthracene, 1-Bromo-
- Bromoanthracene
- 1-Bromoanthracene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Bromoanthracene (purified by sublimation)
CAS:Formula:C14H9BrPurity:>98.0%(GC)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:257.131-Bromoanthracene
CAS:Formula:C14H9BrPurity:>97.0%(GC)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:257.131-Bromoanthracene
CAS:Controlled ProductApplications 1-BROMOANTHRACENE (cas# 7397-92-4) is a useful research chemical.
Formula:C14H9BrColor and Shape:NeatMolecular weight:257.13




