CAS 73972-41-5
:2-methyl-N~1~-(tetrahydrofuran-2-ylmethyl)propane-1,2-diamine
Description:
2-methyl-N~1~-(tetrahydrofuran-2-ylmethyl)propane-1,2-diamine, with CAS number 73972-41-5, is an organic compound characterized by its amine functional groups and a tetrahydrofuran ring. This substance features a branched alkyl chain, which contributes to its unique chemical properties. The presence of the tetrahydrofuran moiety enhances its solubility in polar solvents, making it useful in various chemical applications. As a diamine, it can participate in reactions typical of amines, such as nucleophilic substitutions and the formation of amides or imines. Its structure suggests potential applications in the synthesis of polymers, pharmaceuticals, or as a building block in organic synthesis. Additionally, the compound's properties, such as boiling point, melting point, and reactivity, would be influenced by the steric and electronic effects of the substituents on the amine groups. Safety data should be consulted for handling and storage, as amines can be hazardous. Overall, this compound represents a versatile intermediate in organic chemistry.
Formula:C9H20N2O
InChI:InChI=1/C9H20N2O/c1-9(2,10)7-11-6-8-4-3-5-12-8/h8,11H,3-7,10H2,1-2H3
SMILES:CC(C)(CNCC1CCCO1)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.