CAS 73973-01-0

3-(2-methyl-1H-indol-3-yl)-2-benzofuran-1(3H)-one

Description:

3-(2-methyl-1H-indol-3-yl)-2-benzofuran-1(3H)-one, with the CAS number 73973-01-0, is a chemical compound that features a complex structure combining an indole and a benzofuran moiety. This compound is characterized by its unique heterocyclic framework, which contributes to its potential biological activity. The presence of the indole ring, known for its occurrence in many natural products and pharmaceuticals, suggests possible interactions with biological systems, particularly in the realm of medicinal chemistry. The benzofuran component adds to its aromatic character and may influence its solubility and reactivity. Typically, compounds of this nature are studied for their potential pharmacological properties, including anti-inflammatory, anticancer, or neuroprotective effects. The specific characteristics, such as melting point, solubility, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of organic molecules that may hold significance in drug discovery and development.

Formula: C₁₇H₁₃NO₂

InChI: InChI=1/C17H13NO2/c1-10-15(13-8-4-5-9-14(13)18-10)16-11-6-2-3-7-12(11)17(19)20-16/h2-9,16,18H,1H3

SMILES: Cc1c(c2ccccc2[nH]1)C1c2ccccc2C(=O)O1