CAS 73978-74-2
:2,6-dimethoxy-5-nitropyrimidin-4-amine
Description:
2,6-Dimethoxy-5-nitropyrimidin-4-amine is a chemical compound that belongs to the class of pyrimidines, which are heterocyclic aromatic organic compounds containing nitrogen atoms in the ring structure. This particular compound features two methoxy groups (-OCH3) at the 2 and 6 positions, a nitro group (-NO2) at the 5 position, and an amino group (-NH2) at the 4 position of the pyrimidine ring. These functional groups contribute to its chemical reactivity and potential applications in pharmaceuticals or agrochemicals. The presence of the nitro group typically enhances the compound's electrophilicity, while the amino and methoxy groups can influence its solubility and interaction with biological targets. The compound is likely to exhibit moderate to high polarity due to the presence of these functional groups, which can affect its behavior in various solvents. Additionally, the specific arrangement of substituents may impart unique biological activities, making it of interest in medicinal chemistry research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C6H8N4O4
InChI:InChI=1/C6H8N4O4/c1-13-5-3(10(11)12)4(7)8-6(9-5)14-2/h1-2H3,(H2,7,8,9)
Synonyms:- 4-pyrimidinamine, 2,6-dimethoxy-5-nitro-
- 2,6-Dimethoxy-5-nitropyrimidin-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.