CAS 7398-52-9

(4-acetylphenyl)acetic acid

Description:

(4-acetylphenyl)acetic acid, with the CAS number 7398-52-9, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with an acetyl group at the para position and a carboxylic acid group, which contributes to its acidic properties. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water, ethanol, and acetone, owing to the presence of the carboxylic acid group. Its molecular structure allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. (4-acetylphenyl)acetic acid may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its derivatives can be synthesized for various applications in organic synthesis and material science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential irritant properties.

Formula: C₁₀H₁₀O₃

InChI: InChI=1/C10H10O3/c1-7(11)9-4-2-8(3-5-9)6-10(12)13/h2-5H,6H2,1H3,(H,12,13)

SMILES: CC(=O)c1ccc(cc1)CC(=O)O

Synonyms:

• Benzeneacetic Acid, 4-Acetyl-
• (4-Acetylphenyl)acetic acid
• 4-(Acetylphenyl) acetic acid

2-(4-Acetylphenyl)acetic acid

CAS: 7398-52-9

Formula: C₁₀H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.1846

Ref: IN-DA005IQ9

2-(4-Acetylphenyl)acetic acid

CAS: 7398-52-9

2-(4-Acetylphenyl)acetic acid

Purity: 98%

Molecular weight: 178.19g/mol

Ref: 54-OR1059569

2-(4-Acetylphenyl)acetic acid

CAS: 7398-52-9

Purity: 98%

Molecular weight: 178.1869965

Ref: 10-F656120

4-Acetylphenylacetic acid

CAS: 7398-52-9

4-Acetylphenylacetic acid (4APA) is a chemical compound that is used as a catalyst. It is also used to functionalize carboxyl groups and to catalyze the reaction between ethylenediamine and citric acid, forming flavylium ion. 4APA can be used in the functionalization of amines with acetic anhydride and N,N-dimethylformamide to form acetic acid amides. 4APA can also be used for the synthesis of citric acids by coupling acetaldehyde with citric acid.

Formula: C₁₀H₁₀O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 178.18 g/mol

Ref: 3D-HAA39852