CAS 7398-76-7

Methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate

Description:

Methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate, with the CAS number 7398-76-7, is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.1]heptane framework. This compound features a carboxylate ester functional group, contributing to its reactivity and solubility properties. The presence of a methyl group at the 2-position of the bicyclic system influences its steric and electronic characteristics, potentially affecting its reactivity in various chemical reactions. Methyl esters are generally known for their pleasant odors and are often used in organic synthesis and as intermediates in the production of pharmaceuticals and agrochemicals. The compound's unique structure may also impart specific properties such as stability under certain conditions and potential applications in materials science. As with many organic compounds, its behavior in reactions can be influenced by factors such as temperature, solvent, and the presence of catalysts. Overall, Methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate is a notable compound in organic chemistry with diverse implications in synthetic applications.

Formula: C₁₀H₁₄O₂

InChI: InChI=1S/C10H14O2/c1-10(9(11)12-2)6-7-3-4-8(10)5-7/h3-4,7-8H,5-6H2,1-2H3

InChI key: InChIKey=AEBDJCUTXUYLDC-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1(C)C2CC(C1)C=C2

Synonyms:

• Methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate
• 5-Norbornene-2-carboxylic acid, 2-methyl-, methyl ester
• Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 2-methyl-, methyl ester
• Methyl 2-methyl-5-norbornene-2-carboxylate
• 5-Methyl-5-(methoxycarbonyl)bicyclo[2.2.1]hept-2-ene

Methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate

CAS: 7398-76-7

Methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate

Purity: 95%

Molecular weight: 166.22g/mol

Ref: 54-OR1053368