CAS 7398-82-5
:1,4-Bis(dichloromethyl)benzene
Description:
1,4-Bis(dichloromethyl)benzene, also known as p-dichloromethylbenzene, is an aromatic compound characterized by its two dichloromethyl groups attached to a benzene ring at the para positions. This compound typically appears as a colorless to pale yellow solid and is known for its relatively high melting point and boiling point compared to many other organic compounds. It is insoluble in water but soluble in organic solvents such as ethanol and ether. The presence of dichloromethyl groups imparts significant reactivity, making it useful in various chemical synthesis processes, particularly in the production of polymers and other organic compounds. However, it is important to handle this substance with care due to its potential toxicity and environmental impact. Proper safety measures, including the use of personal protective equipment and adequate ventilation, are essential when working with this chemical. Additionally, it is classified as a hazardous substance, necessitating adherence to regulatory guidelines for storage and disposal.
Formula:C8H6Cl4
InChI:InChI=1S/C8H6Cl4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4,7-8H
InChI key:InChIKey=VOWDXSFJQOEFSH-UHFFFAOYSA-N
SMILES:C(Cl)(Cl)C1=CC=C(C(Cl)Cl)C=C1
Synonyms:- 1,4-Bis(Dichloromethyl)Benzene
- Benzene, 1,4-bis(dichloromethyl)-
- alpha,alpha,alpha',alpha'-Tetrachloro-p-xylene
- p-(Dichloromethyl)benzal chloride
- p-Xylene, α,α,α′,α′-tetrachloro-
- α,α,α',α'-Tetrachloro-p-xylene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzene, 1,4-bis(dichloromethyl)-
CAS:Formula:C8H6Cl4Purity:95%Color and Shape:SolidMolecular weight:243.94521,4-Bis(dichloromethyl)benzene
CAS:1,4-Bis(dichloromethyl)benzenePurity:95%Molecular weight:243.95g/mol1,4-Bis(dichloromethyl)benzene
CAS:<p>1,4-Bis(dichloromethyl)benzene is an organic compound that is used in the synthesis of pesticides and other chemicals. It has a melting point of about 100 °C and a boiling point of about 240 °C. This compound reacts with dimethylformamide to produce a product that can be used as a pesticide. The reaction time depends on temperature, with higher temperatures producing a faster reaction. The efficiency of this process is increased by using supercritical carbon dioxide instead of water as the solvent.</p>Formula:C8H6Cl4Purity:Min. 95%Molecular weight:243.95 g/mol






