CAS 73986-53-5
:3-[2-[(Dimethylamino)methyl]-1-hydroxycyclohexyl]phenol
Description:
3-[2-[(Dimethylamino)methyl]-1-hydroxycyclohexyl]phenol, with the CAS number 73986-53-5, is a chemical compound that belongs to the class of phenolic compounds. It features a phenol ring substituted with a cyclohexyl group that contains a hydroxyl group and a dimethylamino group. This structure contributes to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the dimethylamino group suggests that the compound may exhibit basic properties, which can influence its solubility and reactivity. Additionally, the hydroxyl group can participate in hydrogen bonding, enhancing its interactions with other molecules. The compound may also possess biological activity, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structure and functional groups make it a subject of interest for further research and application development.
Formula:C15H23NO2
InChI:InChI=1S/C15H23NO2/c1-16(2)11-13-6-3-4-9-15(13,18)12-7-5-8-14(17)10-12/h5,7-8,10,13,17-18H,3-4,6,9,11H2,1-2H3
InChI key:InChIKey=UWJUQVWARXYRCG-UHFFFAOYSA-N
SMILES:OC1(C(CN(C)C)CCCC1)C2=CC(O)=CC=C2
Synonyms:- O-Desmethyltramadol
- Phenol, 3-[2-[(Dimethylamino)Methyl]-1-Hydroxycyclohexyl]-
- 3-[2-[(Dimethylamino)methyl]-1-hydroxycyclohexyl]phenol
- 3-{2-[(Dimethylamino)methyl]-1-hydroxycyclohexyl}phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
O-Desmethyl Tramadol (cis/trans)
CAS:Controlled ProductApplications O-Desmethyl Tramadol, is a metabolite of Tramadol, an analgesic.
References Frink, M.C., et al.: Arzneim-Forsch., 46, 1029 (1996),Formula:C15H23NO2Color and Shape:NeatMolecular weight:249.349

