CAS 73987-04-9
:5-[(benzylamino)methyl]-2-phenyl-1,3-dioxan-5-amine
Description:
5-[(Benzylamino)methyl]-2-phenyl-1,3-dioxan-5-amine, with the CAS number 73987-04-9, is a chemical compound that features a dioxane ring structure, which is characterized by the presence of two ether linkages within a six-membered ring. This compound contains both an amine and a benzylamino group, contributing to its potential as a pharmacologically active agent. The presence of the phenyl groups suggests that it may exhibit aromatic properties, which can influence its reactivity and interactions with biological systems. The dioxan moiety can enhance solubility in organic solvents, while the amine functionality may participate in hydrogen bonding and other interactions. This compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents, due to its structural features that could facilitate interactions with biological targets. However, specific biological activity, toxicity, and stability would require further investigation through experimental studies.
Formula:C18H22N2O2
InChI:InChI=1/C18H22N2O2/c19-18(12-20-11-15-7-3-1-4-8-15)13-21-17(22-14-18)16-9-5-2-6-10-16/h1-10,17,20H,11-14,19H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
m-Dioxan-5-amine, 5-benzylaminomethyl-2-phenyl-
CAS:<p>m-Dioxan-5-amine, 5-benzylaminomethyl-2-phenyl- is a bioactive chemical.</p>Formula:C18H22N2O2Color and Shape:SolidMolecular weight:298.38
