CymitQuimica logo

CAS 7399-69-1

:

N-(2-hydroxyethyl)-3-nitrobenzamide

Description:
N-(2-hydroxyethyl)-3-nitrobenzamide, with the CAS number 7399-69-1, is an organic compound characterized by its amide functional group, which is linked to a nitro-substituted aromatic ring. The presence of the hydroxyethyl group contributes to its solubility in polar solvents, while the nitro group introduces significant electron-withdrawing properties, influencing the compound's reactivity and potential applications. This compound typically exhibits moderate stability under standard conditions but may undergo hydrolysis or reduction reactions depending on the environment. Its structural features suggest potential uses in pharmaceuticals or as a chemical intermediate in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and specific conditions. Safety data should be consulted to understand its handling and toxicity, as nitro compounds can pose health risks. Overall, N-(2-hydroxyethyl)-3-nitrobenzamide is a versatile compound with applications in various chemical and biological contexts.
Formula:C9H10N2O4
InChI:InChI=1/C9H10N2O4/c12-5-4-10-9(13)7-2-1-3-8(6-7)11(14)15/h1-3,6,12H,4-5H2,(H,10,13)
SMILES:c1cc(cc(c1)N(=O)=O)C(=NCCO)O
Synonyms:
  • benzamide, N-(2-hydroxyethyl)-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.