CAS 73995-16-1

benzyl S-benzylcysteinate 4-methylbenzenesulfonate (1:1)

Description:

Benzyl S-benzylcysteinate 4-methylbenzenesulfonate (1:1) is a chemical compound characterized by its unique structure, which includes a benzyl group and a cysteine derivative. This compound typically exhibits properties associated with both the benzyl and sulfonate functional groups, such as solubility in polar solvents and potential reactivity in biological systems. The presence of the sulfonate group may enhance its water solubility and influence its interaction with biological molecules. Additionally, the cysteine moiety suggests potential for thiol-related reactivity, which can be significant in biochemical processes. The compound may be utilized in various applications, including pharmaceuticals and biochemical research, due to its ability to participate in redox reactions and form complexes with metal ions. Its stability, reactivity, and solubility characteristics make it a subject of interest in synthetic chemistry and medicinal chemistry. As with any chemical substance, safety data and handling precautions should be observed, particularly due to the potential biological activity associated with its structure.

Formula: C₂₄H₂₇NO₅S₂

InChI: InChI=1/C17H19NO2S.C7H8O3S/c18-16(13-21-12-15-9-5-2-6-10-15)17(19)20-11-14-7-3-1-4-8-14;1-6-2-4-7(5-3-6)11(8,9)10/h1-10,16H,11-13,18H2;2-5H,1H3,(H,8,9,10)

SMILES: c1ccc(cc1)COC(=O)C(CSCc1ccccc1)N.Cc1ccc(cc1)S(=O)(=O)O

Synonyms:

• Cysteine(Bzl)-Obzl P-Tosylate

S-Benzyl-L-cysteine benzyl ester 4-toluenesulfonate salt

CAS: 73995-16-1

S-Benzyl-L-cysteine benzyl ester 4-toluenesulfonate salt is a deodorant that contains an antiperspirant. It is used in combination with other deodorants to provide protection against body odor, underarm wetness and sweating. S-Benzyl-L-cysteine benzyl ester 4-toluenesulfonate salt has been shown to inhibit the production of sweat from the apocrine glands. This drug also works by inhibiting bacterial activity, which causes body odor.

Formula: C₁₇H₁₉NO₂S·C₇H₈O₃S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 473.61 g/mol

Ref: 3D-FB48659