CAS 7400-06-8
:6-amino-5-(2,2-diethoxyethyl)pyrimidin-4(1H)-one
Description:
6-Amino-5-(2,2-diethoxyethyl)pyrimidin-4(1H)-one is a pyrimidine derivative characterized by the presence of an amino group and a diethoxyethyl substituent. This compound features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The amino group at position 6 contributes to its basicity and potential reactivity, while the diethoxyethyl group at position 5 enhances its lipophilicity and solubility in organic solvents. The presence of the ethoxy groups may also influence its pharmacological properties, making it of interest in medicinal chemistry. This compound is typically synthesized through multi-step organic reactions and may exhibit biological activity, potentially serving as a precursor or intermediate in the development of pharmaceuticals. Its CAS number, 7400-06-8, allows for easy identification in chemical databases and literature. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C10H17N3O3
InChI:InChI=1/C10H17N3O3/c1-3-15-8(16-4-2)5-7-9(11)12-6-13-10(7)14/h6,8H,3-5H2,1-2H3,(H3,11,12,13,14)
SMILES:CCOC(Cc1c(N)ncnc1O)OCC
Synonyms:- 4-Pyrimidinol, 6-Amino-5-(2,2-Diethoxyethyl)-
- 6-Amino-5-(2,2-diethoxyethyl)pyrimidin-4-ol
- 6-amino-5-(2,2-diethoxyethyl)pyrimidin-4(3H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Amino-5-(2,2-diethoxyethyl)pyrimidin-4-ol
CAS:Formula:C10H17N3O3Purity:97%Color and Shape:SolidMolecular weight:227.26036-Amino-5-(2,2-diethoxyethyl)pyrimidin-4-ol
CAS:6-Amino-5-(2,2-diethoxyethyl)pyrimidin-4-olPurity:97%Molecular weight:227.26g/mol6-Amino-5(2,2-diethoxyethyl)-4-hydroxy pyrimidine
CAS:6-Amino-5(2,2-diethoxyethyl)-4-hydroxy pyrimidine is a reagent that is used in the synthesis of various chemical substances. It is a versatile building block and can be used as an intermediate for the production of fine chemicals. 6-Amino-5(2,2-diethoxyethyl)-4-hydroxy pyrimidine has been shown to have high reactivity and selectivity, making it a useful scaffold for organic synthesis. This compound can be used as an intermediate for the production of complex compounds such as pharmaceuticals, agrochemicals, or perfumes. 6-Amino-5(2,2-diethoxyethyl)-4-hydroxy pyrimidine is also known to be useful in research fields such as biology and medicine.Formula:C10H17N3O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:227.26 g/mol




