CAS 7400-97-7

2-(3-Amino-4-methylphenoxy)acetic acid

Description:

2-(3-Amino-4-methylphenoxy)acetic acid, with the CAS number 7400-97-7, is an organic compound characterized by its aromatic structure and functional groups. It features an amino group (-NH2) and a carboxylic acid group (-COOH), which contribute to its polar nature and potential for hydrogen bonding. The presence of the phenoxy group indicates that it has a phenolic structure, which can influence its reactivity and solubility in various solvents. This compound is likely to exhibit properties typical of amino acids, such as being zwitterionic in solution, depending on the pH. Its molecular structure suggests potential applications in pharmaceuticals or as a biochemical reagent, particularly in studies involving amino acid derivatives or phenolic compounds. Additionally, the methyl group on the aromatic ring may affect its steric properties and biological activity. Overall, 2-(3-Amino-4-methylphenoxy)acetic acid is a versatile compound with potential implications in medicinal chemistry and biochemistry.

Formula: C₉H₁₁NO₃

InChI: InChI=1S/C9H11NO3/c1-6-2-3-7(4-8(6)10)13-5-9(11)12/h2-4H,5,10H2,1H3,(H,11,12)

InChI key: InChIKey=IQOQYKSPICNTCG-UHFFFAOYSA-N

SMILES: O(CC(O)=O)C1=CC(N)=C(C)C=C1

Synonyms:

• Acetic acid, [(3-amino-p-tolyl)oxy]-
• 2-(3-Amino-4-methylphenoxy)acetic acid
• NSC 37001
• Acetic acid, 2-(3-amino-4-methylphenoxy)-