CAS 74003-55-7
:3,4-Dibromobenzaldehyde
Description:
3,4-Dibromobenzaldehyde is an organic compound characterized by the presence of two bromine atoms and an aldehyde functional group attached to a benzene ring. Its molecular formula is C7H4Br2O, indicating that it contains seven carbon atoms, four hydrogen atoms, two bromine atoms, and one oxygen atom. This compound typically appears as a pale yellow to brown solid and is known for its aromatic properties due to the benzene ring. The presence of bromine substituents significantly influences its reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. 3,4-Dibromobenzaldehyde can undergo typical reactions associated with aldehydes, such as oxidation and condensation, and its bromine atoms can participate in electrophilic substitution reactions. Additionally, it is important to handle this compound with care due to the potential hazards associated with brominated compounds, including toxicity and environmental concerns.
Formula:C7H4Br2O
InChI:InChI=1/C7H4Br2O/c8-6-2-1-5(4-10)3-7(6)9/h1-4H
SMILES:c1cc(c(cc1C=O)Br)Br
Synonyms:- 3,4-Dibromo-benzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Dibromobenzaldehyde, 99%
CAS:<p>3,4-Dibromobenzaldehyde is used in the preparation of isomeric branched pi-conjugated system with terminal alkyne by reacting with 4-(triisopropylsilylethynyl) phenylacetylene. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentatio</p>Formula:C7H4Br2OPurity:99%Color and Shape:White to cream or pale yellow, Crystals or powder or crystalline powder or lumpsMolecular weight:263.923,4-Dibromobenzaldehyde
CAS:3,4-DibromobenzaldehydeFormula:C7H4Br2OPurity:97%Color and Shape: white to off-white solidMolecular weight:263.91g/mol
