
CAS 740064-68-0
:rel-(1R,2S)-2-[2-(Trifluoromethyl)phenyl]cyclopropanamine
Description:
Rel-(1R,2S)-2-[2-(Trifluoromethyl)phenyl]cyclopropanamine is a chemical compound characterized by its cyclopropane structure, which features a trifluoromethyl group attached to a phenyl ring. The compound exhibits chirality, indicated by its specific stereochemical configuration (1R,2S), which can influence its biological activity and interactions. The presence of the trifluoromethyl group enhances the lipophilicity and metabolic stability of the molecule, making it of interest in medicinal chemistry. This compound may be studied for its potential pharmacological properties, particularly in relation to its amine functionality, which can participate in hydrogen bonding and interact with biological targets. Its unique structural features may contribute to its selectivity and efficacy in various applications, including drug development. As with many compounds containing fluorine, it may also exhibit distinct physical and chemical properties, such as altered boiling and melting points compared to non-fluorinated analogs. Overall, rel-(1R,2S)-2-[2-(Trifluoromethyl)phenyl]cyclopropanamine represents a valuable subject for research in organic and medicinal chemistry.
Formula:C10H10F3N
InChI:InChI=1/C10H10F3N/c11-10(12,13)8-4-2-1-3-6(8)7-5-9(7)14/h1-4,7,9H,5,14H2/t7-,9+/s2
InChI key:InChIKey=BLWIIBGLWOGEQG-OWWGPPLWNA-N
SMILES:C(F)(F)(F)C1=C(C=CC=C1)[C@@H]2[C@@H](N)C2
Synonyms:- rel-(1R,2S)-2-[2-(Trifluoromethyl)phenyl]cyclopropanamine
- Cyclopropanamine, 2-[2-(trifluoromethyl)phenyl]-, trans-
- Cyclopropanamine, 2-[2-(trifluoromethyl)phenyl]-, (1R,2S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.