CymitQuimica logo

CAS 7401-76-5

:

3-(3-methoxyphenyl)-2-oxo-2H-chromen-7-yl acetate

Description:
3-(3-Methoxyphenyl)-2-oxo-2H-chromen-7-yl acetate, with the CAS number 7401-76-5, is a synthetic organic compound belonging to the class of flavonoids, specifically a coumarin derivative. This compound features a chromen-2-one backbone, which is characterized by a fused benzene and pyrone ring structure. The presence of the methoxyphenyl group at the 3-position and an acetate group at the 7-position contributes to its unique chemical properties and potential biological activities. It is typically a yellow to orange crystalline solid, exhibiting solubility in organic solvents like ethanol and dimethyl sulfoxide, while being less soluble in water. The compound may exhibit various pharmacological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in medicinal chemistry and drug development. Its structural features allow for potential interactions with biological targets, which can be explored in further research for therapeutic applications.
Formula:C18H14O5
InChI:InChI=1/C18H14O5/c1-11(19)22-15-7-6-13-9-16(18(20)23-17(13)10-15)12-4-3-5-14(8-12)21-2/h3-10H,1-2H3
Synonyms:
  • 2H-1-benzopyran-2-one, 7-(acetyloxy)-3-(3-methoxyphenyl)-
  • 3-(3-Methoxyphenyl)-2-oxo-2H-chromen-7-yl acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.