CymitQuimica logo

CAS 7401-98-1

:

2,4-dichloro-5-(methylsulfanyl)pyrimidine

Description:
2,4-Dichloro-5-(methylsulfanyl)pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two chlorine atoms and a methylsulfanyl group. Its molecular structure features a six-membered aromatic ring containing nitrogen atoms at the 1 and 3 positions, contributing to its basicity and reactivity. The presence of chlorine atoms at the 2 and 4 positions enhances its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methylsulfanyl group at the 5 position introduces a sulfur atom, which can participate in further chemical transformations and may influence the compound's solubility and reactivity. This compound is of interest in agricultural chemistry, particularly as a potential herbicide or fungicide, due to its ability to interfere with biological processes in target organisms. Additionally, its unique structure may allow for the development of derivatives with tailored properties for specific applications in pharmaceuticals or agrochemicals. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.
Formula:C5H4Cl2N2S
InChI:InChI=1/C5H4Cl2N2S/c1-10-3-2-8-5(7)9-4(3)6/h2H,1H3
InChI key:PQLHCTKAQZYUMI-UHFFFAOYSA-N
SMILES:CSc1cnc(Cl)nc1Cl
Found 4 products.