CAS 74016-19-6
:(E)-2-(3,7-Dimethylocta-2,6-dien-1-yl)cyclopentan-1-one
Description:
(E)-2-(3,7-Dimethylocta-2,6-dien-1-yl)cyclopentan-1-one, with the CAS number 74016-19-6, is an organic compound characterized by its unique structure that includes a cyclopentanone ring and a long aliphatic side chain featuring a diene system. This compound exhibits properties typical of ketones, such as a carbonyl group that contributes to its reactivity and potential for undergoing various chemical transformations, including nucleophilic addition and oxidation. The presence of the diene system in the side chain suggests that it may participate in reactions typical of alkenes, such as electrophilic addition and polymerization. Additionally, the compound's stereochemistry, indicated by the (E) configuration, implies that it has specific geometric isomerism, which can influence its physical properties and reactivity. Overall, this compound may have applications in organic synthesis, fragrance chemistry, or as a potential bioactive molecule, although specific applications would depend on further research into its properties and behavior in various chemical environments.
Formula:C15H24O
InChI:InChI=1/C15H24O/c1-12(2)6-4-7-13(3)10-11-14-8-5-9-15(14)16/h6,10,14H,4-5,7-9,11H2,1-3H3/b13-10+
InChI key:InChIKey=ZNSALEJHPSBXDK-JLHYYAGUNA-N
SMILES:C(/C=C(/CCC=C(C)C)\C)C1C(=O)CCC1
Synonyms:- 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]cyclopentanone
- Cyclopentanone, 2-geranyl-
- Cyclopentanone, 2-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-
- Cyclopentanone, 2-[(2E)-3,7-dimethyl-2,6-octadienyl]-
- Cyclopentanone, 2-(3,7-dimethyl-2,6-octadienyl)-, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Decenyl cyclopentanone
CAS:Decenyl cyclopentanone is a biochemical.Formula:C15H24OColor and Shape:SolidMolecular weight:220.356
