CAS 74018-58-9
:10-fluorobenzo[pqr]tetraphene
Description:
10-Fluorobenzo[pqr]tetraphene is a polycyclic aromatic hydrocarbon characterized by its complex fused ring structure, which includes four interconnected benzene rings and a fluorine atom substituent. This compound exhibits notable electronic properties due to its extended π-conjugation, making it of interest in organic electronics and materials science. The presence of the fluorine atom can influence its reactivity, solubility, and photophysical properties, potentially enhancing its stability and altering its electronic characteristics compared to its non-fluorinated analogs. Typically, compounds like 10-fluorobenzo[pqr]tetraphene are studied for their potential applications in organic semiconductors, light-emitting devices, and as building blocks in the synthesis of more complex molecular architectures. Additionally, the compound's unique structure may impart interesting optical properties, such as fluorescence or phosphorescence, which are valuable in various technological applications. As with many polycyclic aromatic hydrocarbons, considerations regarding toxicity and environmental impact are essential in its handling and application.
Formula:C20H11F
InChI:InChI=1/C20H11F/c21-17-6-2-5-14-11-15-8-7-12-3-1-4-13-9-10-16(19(14)17)20(15)18(12)13/h1-11H
SMILES:c1cc2ccc3cc4cccc(c4c4ccc(c1)c2c34)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.