CAS 7402-69-9
:4-(phenylsulfonyl)phenol
Description:
4-(Phenylsulfonyl)phenol, also known by its CAS number 7402-69-9, is an organic compound characterized by the presence of both a phenolic hydroxyl group and a phenylsulfonyl moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. Its structure features a sulfonyl group (-SO2-) attached to a phenyl ring, which enhances its reactivity and potential applications in various chemical reactions. 4-(Phenylsulfonyl)phenol is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a sulfonylating agent. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many sulfonyl compounds, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C12H10O3S
InChI:InChI=1/C12H10O3S/c13-10-6-8-12(9-7-10)16(14,15)11-4-2-1-3-5-11/h1-9,13H
SMILES:c1ccc(cc1)S(=O)(=O)c1ccc(cc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
