CAS 74022-33-6

2-amino-3-(ethoxycarbonyl)-6-(propan-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium

Description:

2-amino-3-(ethoxycarbonyl)-6-(propan-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium is a chemical compound characterized by its complex bicyclic structure, which includes a thieno[2,3-c]pyridine moiety. This compound features an amino group and an ethoxycarbonyl group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the isopropyl group enhances its lipophilicity, which may influence its biological activity and solubility. As a quaternary ammonium compound, it may exhibit ionic characteristics, impacting its interaction with biological systems and its overall stability. The compound's unique structure suggests potential utility in drug development, particularly in areas targeting neurological or cardiovascular conditions. Its CAS number, 74022-33-6, allows for easy identification in chemical databases, facilitating research and development efforts. Overall, the combination of functional groups and structural features makes this compound a subject of interest for further investigation in synthetic and medicinal chemistry.

Formula: C₁₃H₂₁N₂O₂S

InChI: InChI=1/C13H20N2O2S/c1-4-17-13(16)11-9-5-6-15(8(2)3)7-10(9)18-12(11)14/h8H,4-7,14H2,1-3H3/p+1

Ethyl 2-amino-6-(propan-2-yl)-4H,5H,6H,7H-thieno[2,3-c]pyridine-3-carboxylate

CAS: 74022-33-6

Versatile small molecule scaffold

Formula: C₁₃H₂₀N₂O₂S

Purity: Min. 95%

Molecular weight: 268.38 g/mol

Ref: 3D-ZCA02233