CAS 7403-25-0
:3'-Amino-2',3'-dideoxyadenosine
Description:
3'-Amino-2',3'-dideoxyadenosine, commonly referred to as 3'-Amino-ddA, is a modified nucleoside analog of adenosine. It features an amino group at the 3' position and lacks the hydroxyl group at the 2' and 3' positions, which are characteristic of dideoxynucleosides. This structural modification imparts unique biochemical properties, making it a subject of interest in antiviral and anticancer research. The absence of the 2' and 3' hydroxyl groups prevents the formation of a phosphodiester bond during nucleic acid synthesis, thereby inhibiting viral replication and cellular proliferation. 3'-Amino-ddA can be incorporated into nucleic acids, potentially leading to chain termination during DNA synthesis. Its CAS number, 7403-25-0, is used for identification in chemical databases. The compound's characteristics, including solubility, stability, and reactivity, are influenced by its structural modifications, making it a valuable tool in molecular biology and medicinal chemistry for studying nucleic acid interactions and developing therapeutic agents.
Formula:C10H14N6O2
InChI:InChI=1/C10H14N6O2/c11-5-1-7(18-6(5)2-17)16-4-15-8-9(12)13-3-14-10(8)16/h3-7,17H,1-2,11H2,(H2,12,13,14)/t5-,6+,7+/m0/s1
Synonyms:- [(2S,3S,5R)-3-Amino-5-(6-aminopurin-9-yl)oxolan-2-yl]methanol
- 3'-NH2-ddA
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3'-Amino-2',3'-dideoxyadenosine
CAS:Formula:C10H14N6O2Purity:99%Color and Shape:SolidMolecular weight:250.25723'-Amino-2',3'-dideoxyadenosine
CAS:3'-Amino-2',3'-dideoxyadenosineColor and Shape:Off-White SolidMolecular weight:250.26g/mol3'-Amino-2',3'-dideoxyadenosine
CAS:<p>3'-Amino-2',3'-dideoxyadenosine's lack of a 3'-hydroxyl group makes it a chain terminator for DNA polymerase, a key application in Sanger sequencing. Additionally, the 3'-amino group serves as a functional handle for modifying the 3' end of oligonucleotides with various labels or conjugates, expanding their utility in research and diagnostics.</p>Formula:C10H14N6O2Purity:Min. 98.0 Area-%Color and Shape:White PowderMolecular weight:250.26 g/mol3′-AMINO-2′,3′-DIDEOXYADENOSINE
CAS:Formula:C10H14N6O2Purity:99%;RGColor and Shape:SolidMolecular weight:250.262




