CAS 7403-66-9
:2-Chloro-N,N-bis(1-methylethyl)acetamide
Description:
2-Chloro-N,N-bis(1-methylethyl)acetamide, with the CAS number 7403-66-9, is an organic compound characterized by its amide functional group and the presence of a chlorine atom. This compound features a central acetamide structure, where the nitrogen atom is substituted with two isopropyl groups, contributing to its steric bulk. The chlorine atom is attached to the carbon adjacent to the amide group, which can influence the compound's reactivity and polarity. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic isopropyl groups. The presence of the chlorine atom can also impart unique chemical properties, such as increased reactivity in nucleophilic substitution reactions. Additionally, 2-Chloro-N,N-bis(1-methylethyl)acetamide may be used in various chemical syntheses or as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and usage, as halogenated compounds can pose health and environmental risks.
Formula:C8H16ClNO
InChI:InChI=1/C8H16ClNO/c1-6(2)10(7(3)4)8(11)5-9/h6-7H,5H2,1-4H3
InChI key:InChIKey=CPQZQZNYTZXXBB-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)(C(C)C)C(C)C
Synonyms:- 2-Chloro-N,N-bis(1-methylethyl)acetamide
- 2-Chloro-N,N-bis(propan-2-yl)acetamide
- 2-Chloro-N,N-diisopropylacetamide
- Acetamide, 2-chloro-N,N-bis(1-methylethyl)-
- Acetamide, 2-chloro-N,N-diisopropyl-
- N,N-Diisopropyl carbamoyl methyl chloride
- N,N-Diisopropylchloroacetamide
- NSC 3358
- NSC 54819
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloro-N,N-diisopropylacetamide
CAS:Formula:C8H16ClNOColor and Shape:SolidMolecular weight:177.67172-Chloro-N,N-diisopropylacetamide
CAS:2-Chloro-N,N-diisopropylacetamide is a quinoline derivative that has been shown to be a potent ligand for lanthanide metal ions. It has been used as a fluorescent probe for nitrate anions and shows constant fluorescence intensity over a wide range of pH values. 2-Chloro-N,N-diisopropylacetamide also exhibits luminescence properties and can be used as a sensor for amide anions. The compound has been shown to enhance the emission of lanthanide metal ions in the near infrared region when excited. 2-Chloro-N,N-diisopropylacetamide is also an efficient catalyst for desulfurization reactions.
Formula:C8H16ClNOPurity:Min. 95%Molecular weight:177.67 g/mol



