CAS 7403-75-0
:N-(4-hydroxy-2-nitrophenyl)acetamide
Description:
N-(4-hydroxy-2-nitrophenyl)acetamide, also known by its CAS number 7403-75-0, is an organic compound characterized by its acetamide functional group attached to a phenolic structure. This compound features a nitro group and a hydroxyl group on the aromatic ring, which contribute to its chemical reactivity and potential applications. It typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl group. The nitro group enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may be of interest in fields such as pharmaceuticals, where it could serve as an intermediate in the synthesis of biologically active molecules. Additionally, its structural features suggest potential applications in dye chemistry or as a reagent in analytical chemistry. Safety precautions should be observed when handling this compound, as nitro-substituted compounds can be hazardous.
Formula:C8H8N2O4
InChI:InChI=1/C8H8N2O4/c1-5(11)9-7-3-2-6(12)4-8(7)10(13)14/h2-4,12H,1H3,(H,9,11)
SMILES:CC(=Nc1ccc(cc1N(=O)=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Nitro-4-acetamidophenol
CAS:3-Nitro-4-acetamidophenol is a molecule that is used in research. It has been shown to inhibit the production of nitrous oxide and nitrite, which are reactive nitrogen oxides that can cause acidification. 3-Nitro-4-acetamidophenol inhibits the enzyme nitrate reductase, which reduces nitrate to nitrite ion. It has been shown to have a recirculating effect on the production of these oxidizing agents, but has no effect on acetaminophen metabolism or organic acids. 3-Nitro-4-acetamidophenol is an acidic compound that can be synthesized by reacting an amine with an organic acid in the presence of sodium nitrite.Formula:C8H8N2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:196.16 g/mol3-Nitro-4-acetamidophenol
CAS:Controlled ProductFormula:C8H8N2O4Color and Shape:NeatMolecular weight:196.16


