CAS 74032-89-6
:neurotensin fragment 1-11
Description:
Neurotensin fragment 1-11, with the CAS number 74032-89-6, is a peptide that consists of the first eleven amino acids of the neurotensin molecule. Neurotensin itself is a neuropeptide that plays a significant role in various physiological processes, including the modulation of pain, regulation of body temperature, and influence on dopaminergic pathways. The fragment retains some biological activity, particularly in the central nervous system, where it can interact with neurotensin receptors. Characteristically, this peptide is hydrophilic due to its amino acid composition, which includes polar and charged residues. It is typically synthesized through solid-phase peptide synthesis and can be characterized by techniques such as mass spectrometry and high-performance liquid chromatography (HPLC). Neurotensin fragment 1-11 is of interest in pharmacological research for its potential therapeutic applications, particularly in the context of neuropsychiatric disorders and metabolic regulation. Its stability, solubility, and receptor binding affinity are key factors that influence its biological activity and potential uses in clinical settings.
Formula:C66H99N19O18
InChI:InChI=1/C66H99N19O18/c1-35(2)31-45(80-55(93)41-22-24-52(89)75-41)57(95)81-46(32-36-14-18-38(86)19-15-36)58(96)76-42(23-25-53(90)91)56(94)82-47(34-51(68)88)59(97)79-43(9-3-4-26-67)62(100)84-29-7-12-49(84)60(98)77-40(10-5-27-73-65(69)70)54(92)78-44(11-6-28-74-66(71)72)63(101)85-30-8-13-50(85)61(99)83-48(64(102)103)33-37-16-20-39(87)21-17-37/h14-21,35,40-50,86-87H,3-13,22-34,67H2,1-2H3,(H2,68,88)(H,75,89)(H,76,96)(H,77,98)(H,78,92)(H,79,97)(H,80,93)(H,81,95)(H,82,94)(H,83,99)(H,90,91)(H,102,103)(H4,69,70,73)(H4,71,72,74)/t40-,41-,42-,43-,44-,45-,46-,47-,48+,49-,50-/m0/s1
Synonyms:- Neurotensin (1-11)
- Nt 1-11
- Neurotensin (ox), 12-de-L-isoleucine-13-de-L-leucine-
- Pyr-Leu-Tyr-Glu-Asn-Lys-Pro-Arg-Arg-Pro-Tyr-OH
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.