CAS 74036-95-6
:2-Bromotetradecane
Description:
2-Bromotetradecane is an organic compound classified as a haloalkane, specifically a brominated alkane. It features a tetradecane backbone, which consists of a straight-chain of 14 carbon atoms, with a bromine atom attached to the second carbon in the chain. This structural arrangement gives it unique chemical properties, including increased reactivity compared to its non-brominated counterparts. The presence of the bromine atom introduces a polar functional group, which can enhance its solubility in organic solvents while making it less soluble in water. 2-Bromotetradecane is typically a colorless to pale yellow liquid at room temperature and has a relatively high boiling point due to the presence of the bromine atom, which increases molecular weight and intermolecular forces. It is used in various applications, including organic synthesis and as an intermediate in the production of other chemical compounds. Safety precautions should be taken when handling this substance, as it may pose health risks through inhalation or skin contact.
Formula:C14H29Br
InChI:InChI=1/C14H29Br/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h14H,3-13H2,1-2H3
SMILES:CCCCCCCCCCCCC(C)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Bromotetradecane, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C14H29BrPurity:95%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:277.29


