CAS 74037-48-2
:N-(1,2-diphenylethyl)pyridin-2-amine
Description:
N-(1,2-diphenylethyl)pyridin-2-amine, with the CAS number 74037-48-2, is an organic compound characterized by its unique structure that includes a pyridine ring and a diphenylethyl group. This compound typically exhibits properties associated with both amines and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group. The pyridine moiety contributes to its basicity and potential for coordination with metal ions, while the diphenylethyl group may influence its steric properties and overall stability. This compound may also display interesting biological activities, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various applications, including as a ligand in coordination chemistry or as a precursor in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C19H18N2
InChI:InChI=1/C19H18N2/c1-3-9-16(10-4-1)15-18(17-11-5-2-6-12-17)21-19-13-7-8-14-20-19/h1-14,18H,15H2,(H,20,21)
SMILES:c1ccc(cc1)CC(c1ccccc1)Nc1ccccn1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.