CAS 74039-10-4

Carbamic acid, bicyclo[2.2.1]hept-2-yl-, ethyl ester

Description:

Carbamic acid, bicyclo[2.2.1]hept-2-yl-, ethyl ester, with the CAS number 74039-10-4, is an organic compound characterized by its bicyclic structure, which features a bicyclo[2.2.1]heptane framework. This compound contains a carbamate functional group, which is derived from carbamic acid, and is esterified with ethyl alcohol. The presence of the bicyclic structure contributes to its unique chemical properties, including potential steric hindrance and specific reactivity patterns. Typically, carbamates exhibit moderate stability and can participate in various chemical reactions, such as hydrolysis and transesterification. The compound may also display biological activity, making it of interest in fields such as medicinal chemistry and agrochemicals. Its solubility and volatility can vary based on the specific substituents and the overall molecular structure. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₇NO₂

InChI: InChI=1S/C10H17NO2/c1-2-13-10(12)11-9-6-7-3-4-8(9)5-7/h7-9H,2-6H2,1H3,(H,11,12)

InChI key: InChIKey=BEEMRXRYLIWEJL-UHFFFAOYSA-N

SMILES: N(C(OCC)=O)C1C2CC(C1)CC2

Synonyms:

• Carbamic acid, bicyclo[2.2.1]hept-2-yl-, ethyl ester
• NSC 102513