CAS 74046-15-4

α-L-Arabinopyranoside, 2-(3,4-dihydroxyphenyl)-3,4-dihydro-4,5,7-trihydroxy-2H-1-benzopyran-3-yl

Description:

α-L-Arabinopyranoside, 2-(3,4-dihydroxyphenyl)-3,4-dihydro-4,5,7-trihydroxy-2H-1-benzopyran-3-yl, with CAS number 74046-15-4, is a glycoside compound characterized by its complex structure that includes a sugar moiety (α-L-arabinopyranoside) linked to a flavonoid-like aglycone. This compound features multiple hydroxyl groups, contributing to its potential antioxidant properties. The presence of the benzopyran structure suggests it may exhibit biological activities, including anti-inflammatory and antimicrobial effects. Its solubility is likely influenced by the sugar component, which can enhance its interaction with biological systems. The compound's stereochemistry and functional groups play a crucial role in its reactivity and interactions with other molecules. As a natural product, it may be derived from plant sources and could have applications in pharmaceuticals or nutraceuticals, particularly in the context of health benefits associated with polyphenolic compounds. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.

Formula: C₂₀H₂₂O₁₁

InChI: InChI=1S/C20H22O11/c21-8-4-11(24)14-13(5-8)30-18(7-1-2-9(22)10(23)3-7)19(16(14)27)31-20-17(28)15(26)12(25)6-29-20/h1-5,12,15-28H,6H2

InChI key: InChIKey=YISJRMFABYGQSX-UHFFFAOYSA-N

SMILES: O(C1C(OC=2C(C1O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3)C4C(O)C(O)C(O)CO4

Synonyms:

• α-L-Arabinopyranoside, 2-(3,4-dihydroxyphenyl)-3,4-dihydro-4,5,7-trihydroxy-2H-1-benzopyran-3-yl
• Loquatoside

Loquatoside

CAS: 74046-15-4

Loquatoside: A C3-linked flavonoid glycoside; slightly water-soluble and weakly acidic solid; found in cytoplasm, fruits, and loquat.

Formula: C₂₀H₂₂O₁₁

Color and Shape: Solid

Molecular weight: 438.385

Ref: TM-T32876